PRODUCT Properties
| Melting point: | 150-152 °C (lit.) |
| solubility | methylene chloride: soluble25mg/mL, clear, colorless to yellow |
| InChI | 1S/C6H5NO2/c8-5-6-1-3-7(9)4-2-6/h1-5H |
| InChIKey | ZAZQKVZJRMHPQP-UHFFFAOYSA-N |
| SMILES | [H]C(=O)c1cc[n+]([O-])cc1 |
Description and Uses
4-Pyridinecarboxaldehyde N-Oxide is an impurity of Donepezil (D531750), a nootropic. An inhibitor of acetylcholinesterase. Also a reagent in the preparation of pyridine N-oxides.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




![2-[(1-Benzylpiperidin-4-yl)hydroxyMethyl]-5,6-diMethoxyindan-1-one](https://img.chemicalbook.com/CAS/GIF/197010-20-1.gif)


