S552078
Triethyl 3-methyl-4-phosphono-2-butenoate, mixture of cis and trans , technicalgrade,80% , 41891-54-7
Synonym(s):
Diethyl 3-ethoxycarbonyl-2-methyl-2-propenyl phosphonate;Triethyl 3-methyl-4-phosphonocrotonate;Triethyl 4-phosphonosenecioate, mixture of cis and trans
CAS NO.：41891-54-7
Empirical Formula: C11H21O5P
Molecular Weight: 264.26
MDL number: MFCD00075151
EINECS: 202-620-9
| Pack Size | Price | Stock | Quantity |
| 5g | RMB575.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 284-287 °C(lit.) |
| Density | 1.089 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform, Ethyl Acetate |
| form | Oil |
| color | Clear Colourless to Pale Yellow |
| BRN | 2417880 |
| InChI | InChI=1S/C11H21O5P/c1-5-14-11(12)8-10(4)9-17(13,15-6-2)16-7-3/h8H,5-7,9H2,1-4H3 |
| InChIKey | OQKGPUSERILONW-CSKARUKUSA-N |
| SMILES | C(OCC)(=O)C=C(C)CP(OCC)(OCC)=O |
Description and Uses
Triethyl 3-Methyl-4-phosphono-2-butenoate is used in the synthesis of potent insect growth regulators. Also used in the synthesis of retinoic acids. This compound is an E/Z mixture.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| PPE | Eyeshields, Gloves, multi-purpose combination respirator cartridge (US) |
| Safety Statements | 23-24/25 |
| WGK Germany | 3 |
| HS Code | 29319090 |
| Storage Class | 10 - Combustible liquids |
