S5787353
certifiedreferencematerial,TraceCERT , 1085-98-9
CAS NO.:1085-98-9
Empirical Formula: C9H11Cl2FN2O2S2
Molecular Weight: 333.23
MDL number: MFCD00078639
EINECS: 214-118-7
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 110-112℃ (ethanol ) |
| Boiling point: | 154°C (rough estimate) |
| Density | 1.5752 (rough estimate) |
| vapor pressure | 1.5 x 10-5 Pa (20 °C) |
| refractive index | 1.6000 (estimate) |
| Flash point: | 2 °C |
| storage temp. | APPROX 4°C |
| Water Solubility | 1.3 mg l-1 (20 °C) |
| pka | -5.37±0.50(Predicted) |
| Merck | 13,3070 |
| BRN | 2947992 |
| Major Application | agriculture environmental |
| InChI | 1S/C9H11Cl2FN2O2S2/c1-13(2)18(15,16)14(17-9(10,11)12)8-6-4-3-5-7-8/h3-7H,1-2H3 |
| InChIKey | WURGXGVFSMYFCG-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)N(SC(F)(Cl)Cl)c1ccccc1 |
| CAS DataBase Reference | 1085-98-9 |
| EPA Substance Registry System | Dichlofluanid (1085-98-9) |
Description and Uses
Dichlofluanid is solid sparingly soluble in water, soluble in most organic solvents, and decomposes in alkaline media.
Fungicide.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H317-H319-H332-H400 |
| Precautionary statements | P261-P273-P280-P302+P352-P304+P340+P312-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn,N,F |
| Risk Statements | 20-36-43-50/53-20/21/22-11-50 |
| Safety Statements | 24-37-60-61-36-26-16-36/37 |
| RIDADR | 2588 |
| WGK Germany | 3 |
| RTECS | WO6475000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Inhalation Aquatic Acute 1 Eye Irrit. 2 Skin Sens. 1 |
| Hazardous Substances Data | 1085-98-9(Hazardous Substances Data) |
| Toxicity | LD50 in rats, guinea pigs, rabbits (mg/kg): 1.000 orally in all species (Grewe) |




