PRODUCT Properties
Melting point: | 125℃/2mm |
Boiling point: | 266°C |
Density | 1,1 g/cm3 |
refractive index | n20/D1.464 |
Flash point: | >100°C |
storage temp. | 2-8°C |
form | liquid |
Appearance | Colorless to light yellow Liquid |
Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
InChI | InChI=1S/C12H18O6/c1-3-11(13)17-9-7-15-5-6-16-8-10-18-12(14)4-2/h3-4H,1-2,5-10H2 |
InChIKey | INQDDHNZXOAFFD-UHFFFAOYSA-N |
SMILES | C(OCCOC(=O)C=C)COCCOC(=O)C=C |
EPA Substance Registry System | Triethylene glycol diacrylate (1680-21-3) |
Description and Uses
Triethylene glycol diacrylate is a cross-linking acrylate monomer for use in coatings, adhesives, and printing plates of the photoprepolymer type.
Safety
Symbol(GHS) | ![]() GHS07 |
Signal word | Warning |
Hazard statements | H315-H317-H319 |
Precautionary statements | P261-P264-P272-P280-P302+P352-P305+P351+P338 |
Hazard Codes | Xi |
Risk Statements | 36/37/38-43-36/38 |
Safety Statements | 26-36/37/39-28 |
WGK Germany | 3 |
RTECS | AS8150000 |
Toxicity | LD50 orl-rat: 500 mg/kg 85GMAT -,115,82 |