PRODUCT Properties
| Melting point: | 125℃/2mm | 
                                    
| Boiling point: | 266°C | 
                                    
| Density | 1,1 g/cm3 | 
                                    
| refractive index | n20/D1.464 | 
                                    
| Flash point: | >100°C | 
                                    
| storage temp. | 2-8°C | 
                                    
| form | liquid | 
                                    
| Appearance | Colorless to light yellow Liquid | 
                                    
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. | 
                                    
| InChI | InChI=1S/C12H18O6/c1-3-11(13)17-9-7-15-5-6-16-8-10-18-12(14)4-2/h3-4H,1-2,5-10H2 | 
                                    
| InChIKey | INQDDHNZXOAFFD-UHFFFAOYSA-N | 
                                    
| SMILES | C(OCCOC(=O)C=C)COCCOC(=O)C=C | 
                                    
| EPA Substance Registry System | Triethylene glycol diacrylate (1680-21-3) | 
                                    
Description and Uses
Triethylene glycol diacrylate is a cross-linking acrylate monomer for use in coatings, adhesives, and printing plates of the photoprepolymer type.
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H315-H317-H319 | 
| Precautionary statements | P261-P264-P272-P280-P302+P352-P305+P351+P338 | 
| Hazard Codes | Xi | 
| Risk Statements | 36/37/38-43-36/38 | 
| Safety Statements | 26-36/37/39-28 | 
| WGK Germany | 3 | 
| RTECS | AS8150000 | 
| Toxicity | LD50 orl-rat: 500 mg/kg 85GMAT -,115,82 | 





