S5889249
4-Hydroxyantipyrine , 99% , 1672-63-5
Synonym(s):
4-Hydroxy-2,3-dimethyl-1-phenyl-3-pyrazolin-5-one;NSC 174055
| Pack Size | Price | Stock | Quantity |
| 5g | RMB872.74 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 184-186 °C (lit.) |
| Boiling point: | 314.3±52.0 °C(Predicted) |
| Density | 1.294±0.06 g/cm3(Predicted) |
| storage temp. | Refrigerator |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 11.99±0.20(Predicted) |
| form | Solid |
| color | Off-White to Beige |
| InChI | 1S/C11H12N2O2/c1-8-10(14)11(15)13(12(8)2)9-6-4-3-5-7-9/h3-7,14H,1-2H3 |
| InChIKey | SKVPTPMWXJSBTF-UHFFFAOYSA-N |
| SMILES | CN1N(c2ccccc2)C(=O)C(O)=C1C |
Description and Uses
Antipyrine metabolite
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
