S604178
Chlorobis(trimethylsilyl)methane , 97% , 5926-35-2
Synonym(s):
Bis(trimethylsilyl)chloromethane
| Pack Size | Price | Stock | Quantity |
| 5g | RMB735.37 | In Stock |
|
| 25g | RMB1970.58 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 57-60 °C/15 mmHg (lit.) |
| Density | 0.892 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 120 °F |
| solubility | soluble in common organic solvents (DMF, THF,
Et2O, CH2Cl2). |
| form | liquid |
| Specific Gravity | 0.892 |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| BRN | 1736681 |
| InChI | 1S/C7H19ClSi2/c1-9(2,3)7(8)10(4,5)6/h7H,1-6H3 |
| InChIKey | XNJGZHVYPBNLEB-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C(Cl)[Si](C)(C)C |
Description and Uses
Silane, 1,1-(Chloromethylene)bis[1,1,1]- trimethyl- can be used as versatile C1 building block; broad application in Peterson olefination reactions; Grignard reagent participates readily in Kumada cross-coupling reactions with aryl and vinyl halides; useful in synthesis of methylenephosphine analogs and as sterically demanding ligand for a number of main group and transition metal complexes.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 26-36/37/39 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| F | 21 |
| TSCA | No |
| HazardClass | 3.2 |
| PackingGroup | III |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |








