S6151251
(4-TERT-BUTYLCYCLOHEXYL)ACETICACID , AldrichCPR
| Pack Size | Price | Stock | Quantity |
| 10MG | RMB117.90 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 81-83 °C |
| Boiling point: | 300.1±10.0 °C(Predicted) |
| Density | 0.967±0.06 g/cm3(Predicted) |
| pka | 4.72±0.10(Predicted) |
| InChI | InChI=1S/C12H22O2/c1-12(2,3)10-6-4-9(5-7-10)8-11(13)14/h9-10H,4-8H2,1-3H3,(H,13,14) |
| InChIKey | UEERPCZVXPLDMN-UHFFFAOYSA-N |
| SMILES | C1(CC(O)=O)CCC(C(C)(C)C)CC1 |
Description and Uses
4-Tert-Butylcyclohexyl acetic acid is used primarily in the fragrance industry due to its strong, woody, amber-like scent, serving as a key ingredient in perfumes, soaps, cosmetics, and household cleaning products . Additionally, it functions as a fixative agent in perfume formulations to enhance scent longevity .
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P280 |
| Hazard Codes | Xi |
| HS Code | 2916200090 |




![Methyl(3S,8S,9S,10R,13S,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-17-carboxylate](https://img.chemicalbook.com/CAS/GIF/7254-03-7.gif)
