S6161849
Malonicacid-d4 , 98atom%D,99%(CP) , 813-56-9
Synonym(s):
Propanedioic-2,2-d2 acid-1,3-d2;Tetradeuteriomalonic acid
CAS NO.:813-56-9
Empirical Formula: C3D4O4
Molecular Weight: 108.09
MDL number: MFCD00002710
EINECS: 212-385-4
| Pack Size | Price | Stock | Quantity |
| 10g | RMB603.87 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 132-135 °C (dec.) (lit.) |
| storage temp. | Hygroscopic, Refrigerator, under inert atmosphere |
| solubility | DMSO, Metahnol |
| form | Solid |
| color | White |
| Stability: | Moisture Sensitive |
| InChI | 1S/C3H4O4/c4-2(5)1-3(6)7/h1H2,(H,4,5)(H,6,7)/i1D2/hD2 |
| InChIKey | OFOBLEOULBTSOW-BGOGGDMHSA-N |
| SMILES | [2H]OC(=O)C([2H])([2H])C(=O)O[2H] |
| CAS Number Unlabeled | 141-82-2 |
Description and Uses
Malonic Acid-d4 is the isotope labelled analog of Malonic Acid (M158005); a small bioactive molecule that can be used in various reactions. It is the classic example of a competitive inhibitor which acts against succinate dehydrogenase (complex II) in the respiratory electron transport chain.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319 |
| Precautionary statements | P264-P270-P280-P301+P312-P305+P351+P338-P337+P313 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| HS Code | 28459000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Dam. 1 |




