S619378
Thulium(III) acetate hydrate , 99.9%tracemetalsbasis , 207738-11-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB607.91 | In Stock |
|
| 5g | RMB2187.63 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| form | powder |
| InChI | 1S/3C2H4O2.H2O.Tm/c3*1-2(3)4;;/h3*1H3,(H,3,4);1H2;/q;;;;+3/p-3 |
| InChIKey | GKCQSJXCECKBHO-UHFFFAOYSA-K |
| SMILES | O.CC(=O)O[Tm](OC(C)=O)OC(C)=O |
Description and Uses
Thulium(III) acetate hydrate is a chemical compound containing the rare earth element thulium. It can be used as a precursor in the synthesis of core-shell nanocrystals.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| WGK Germany | 3 |
| HS Code | 2915290000 |
| Storage Class | 11 - Combustible Solids |





