PRODUCT Properties
| Flash point: | 9℃ |
| storage temp. | 2-8°C |
| solubility | DMF: 10 mg/ml; DMSO: 10 mg/ml; Ethanol: 16 mg/ml; PBS (pH 7.2): 5 mg/ml |
| form | A crystalline solid |
| Major Application | forensics and toxicology |
| InChI | 1S/C12H17NO2.ClH/c1-3-10(13-2)6-9-4-5-11-12(7-9)15-8-14-11;/h4-5,7,10,13H,3,6,8H2,1-2H3;1H |
| InChIKey | LFXXIXAVEJVYGY-UHFFFAOYSA-N |
| SMILES | Cl.N(C(CC)Cc1cc2c(cc1)OCO2)C |
Description and Uses
MBDB ia an analog of MDMA (M303985). MBDB is the N-methylated derivative of BDB (B198900), a hallucinogenic Phenylethylamine derivative. BDB is more potent than MBDB. MBDB is a CNS stimulant.
Safety
| Symbol(GHS) |    GHS02,GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H225-H301+H311+H331-H370 |
| Precautionary statements | P210-P280-P301+P310+P330-P302+P352+P312-P304+P340+P311 |
| target organs | Eyes |
| Hazard Codes | F,T |
| Risk Statements | 11-23/24/25-39/23/24/25 |
| Safety Statements | 16-36/37-45 |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution |
| WGK Germany | 1 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 |