PRODUCT Properties
| Melting point: | 180-182°C |
| alpha | D25 -173° (water) |
| Boiling point: | 610.1±55.0 °C(Predicted) |
| Density | 1.50±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | DMSO : 250 mg/mL (643.72 mM; Need ultrasonic) |
| pka | 12.79±0.70(Predicted) |
| form | powder |
| color | White |
| Merck | 13,10021 |
| BRN | 57895 |
| Major Application | metabolomics vitamins, nutraceuticals, and natural products |
| InChIKey | HLXRWTJXGMHOFN-XJSNKYLASA-N |
| SMILES | [C@@]12([H])[C@@H](C)CC(=O)[C@]1([H])C(C(=O)OC)=CO[C@H]2O[C@H]1[C@H](O)[C@H]([C@H](O)[C@@H](CO)O1)O |&1:0,2,7,16,18,19,21,22,24,r| |
| LogP | -2.390 (est) |
| CAS DataBase Reference | 548-37-8 |
Description and Uses
Verbenalin is an iridoid glucoside isolated found in Verbena officinalis and other herb plants.




