S6342249
1-(2,3-Xylyl)piperazinemonohydrochloride , 98% , 80836-96-0
| Pack Size | Price | Stock | Quantity |
| 25g | RMB627.53 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C(lit.) |
| Boiling point: | 95-97°C 0,2mm |
| Density | 0.9306 (rough estimate) |
| refractive index | 1.5600 (estimate) |
| form | powder |
| InChI | 1S/C12H18N2.ClH/c1-10-4-3-5-12(11(10)2)14-8-6-13-7-9-14;/h3-5,13H,6-9H2,1-2H3;1H |
| InChIKey | SHOLVQVIKRVCGQ-UHFFFAOYSA-N |
| SMILES | Cl[H].Cc1cccc(N2CCNCC2)c1C |
| CAS DataBase Reference | 80836-96-0(CAS DataBase Reference) |
Description and Uses
1-(2,3-Xylyl)piperazine monohydrochloride may be used in chemical synthesis studies.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
