S6383149
1-Boc-4-(4-methoxycarbonylphenyl)piperazine , 97% , 158985-36-5
Synonym(s):
Methyl 4-(Boc-piperazin-1-yl)-benzoate
| Pack Size | Price | Stock | Quantity |
| 1g | RMB1281.41 | In Stock |
|
| 5g | RMB3394.22 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 166-170 °C (lit.) |
| storage temp. | Store at room temperature |
| form | solid |
| Appearance | White to off-white Solid |
| InChI | 1S/C17H24N2O4/c1-17(2,3)23-16(21)19-11-9-18(10-12-19)14-7-5-13(6-8-14)15(20)22-4/h5-8H,9-12H2,1-4H3 |
| InChIKey | SMDBCJAJWDCJOP-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(cc1)N2CCN(CC2)C(=O)OC(C)(C)C |
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H300 |
| Precautionary statements | P264-P270-P301+P310-P405-P501 |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Statements | 25-52/53 |
| Safety Statements | 45 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 2 |
| Hazard Note | Harmful |
| HS Code | 2933599590 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Oral |
