S6415349
Citricacid-2,2,4,4-d4 , 98atom%D,98%(CP) , 147664-83-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB14949.45 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 153-159 °C (lit.) |
| storage temp. | -20°C Freezer |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| color | White to Off-White |
| InChI | InChI=1S/C6H8O7/c7-3(8)1-6(13,5(11)12)2-4(9)10/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/i1D2,2D2 |
| InChIKey | KRKNYBCHXYNGOX-LNLMKGTHSA-N |
| SMILES | C(O)(C(=O)O)(C([2H])([2H])C(=O)O)C([2H])([2H])C(=O)O |
| CAS Number Unlabeled | 77-92-9 |
Description and Uses
Widely distributed in plants and in animal tissues and fluids. Produced by mycological fermentation on an industrial scale using crude sugar solutions, such as molasses and strains of Aspergillus niger.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H318-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 37/38-41 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 STOT SE 3 |








