S6430649
4-Aminophenol-d7 , 98atom%D , 285132-88-9
Synonym(s):
4-(Amino-d2)phen-2,3,5,6-d4-ol
| Pack Size | Price | Stock | Quantity |
| 1g | RMB6652.54 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 188-190 °C (lit.) |
| Flash point: | 195℃ |
| solubility | DMSO (Sparingly), Methanol (Slightly) |
| form | Solid |
| color | Brown to Very Dark Brown |
| InChI | 1S/C6H7NO/c7-5-1-3-6(8)4-2-5/h1-4,8H,7H2/i1D,2D,3D,4D/hD3 |
| InChIKey | PLIKAWJENQZMHA-ZZLZVNDKSA-N |
| SMILES | [2H]Oc1c([2H])c([2H])c(N([2H])[2H])c([2H])c1[2H] |
| CAS Number Unlabeled | 123-30-8 |
Description and Uses
4-Aminophenol-d7 is a reagent used in the synthesis of labeled ambroxol and its major metabolites.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS07,GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H302+H332-H341-H410 |
| Precautionary statements | P202-P261-P273-P301+P312-P304+P340+P312-P308+P313 |
| Hazard Codes | Xn,N |
| Risk Statements | 20/21/22-36/37/38-40-42/43-68-50/53-20/22 |
| Safety Statements | 22-26-36-61-60-36/37-28 |
| RIDADR | UN 2512 6.1/PG 3 |
| WGK Germany | 3 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Muta. 2 |









