S6474249
Sodiumcarbonate-13C , 99atom%13C , 93673-48-4
Synonym(s):
13C Labeled sodium carbonate;Calcined soda-13C;Carbonic acid disodium salt-13C;Soda ash-13C
| Pack Size | Price | Stock | Quantity |
| 1g | RMB1325.26 | In Stock |
|
| 5G | RMB2998.57 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 851 °C (lit.) |
| form | powder |
| InChI | InChI=1S/CH2O3.2Na/c2-1(3)4;;/h(H2,2,3,4);;/q;2*+1/p-2/i1+1;; |
| InChIKey | CDBYLPFSWZWCQE-GOCMCNPZSA-L |
| SMILES | [13C]([O-])([O-])=O.[Na+].[Na+] |
| CAS Number Unlabeled | 497-19-8 |
Description and Uses
Sodium carbonate-13C is primarily used in scientific research and technological development. In chemical research, it serves as an isotope label to help trace chemical reaction pathways or study molecular dynamics. In environmental science, it can be used to analyze carbon cycle processes, such as simulating the absorption and release of carbon dioxide through labeling experiments. In industry, it is sometimes used as an internal standard to calibrate analytical instruments and ensure measurement accuracy.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36 |
| Safety Statements | 22-26-36/37/39 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 |
