CresylVioletperchlorate , 41830-80-2
Synonym(s):
Oxazine 9 perchlorate
CAS NO.:41830-80-2
Empirical Formula: C16H12ClN3O5
Molecular Weight: 361.74
MDL number: MFCD00012671
EINECS: 255-561-6
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB613.02 | In Stock |
|
| 500mg | RMB2203.24 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Density | 1.4795 (rough estimate) |
| refractive index | 1.6500 (estimate) |
| storage temp. | room temp |
| form | Powder |
| color | Green |
| λmax | 602 nm |
| ε(extinction coefficient) | ≥27000 at 267-273nm ≥50000 at 599-605nm ≥7000 at 316-322nm |
| Stability: | Stable. Incompatible with strong oxidizing agents. Hygroscopic. |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C16H11N3O.ClHO4/c17-9-5-6-13-14(7-9)20-15-8-12(18)10-3-1-2-4-11(10)16(15)19-13;2-1(3,4)5/h1-8,17H,18H2;(H,2,3,4,5) |
| InChIKey | YZUJISGZMSLVAU-UHFFFAOYSA-N |
| SMILES | OCl(=O)(=O)=O.Nc1cc2OC3=CC(=N)C=CC3=Nc2c4ccccc14 |
| EPA Substance Registry System | Benzo[a]phenoxazin-7-ium, 5,9-diamino-, perchlorate (41830-80-2) |
Description and Uses
Cresyl violet 670 Perchlorate is a biomedical product used in research and diagnostics. It is a fluorescent stain that selectively binds to RNA and DNA. Widely employed in histology and cytology, it aids in identifying cell nuclei and nucleic acids. This stain plays a crucial role in studying the effects, structure, and progression of diseases like cancer and neurological disorders.
Among its many applications, Cresyl Violet can be used to stain for Nissl substance and nuclei in nervous tissue and the identification of Helicobacter. Cresyl Violet perchlorate has been used to make cresyl violet perchlorate-polymer composite thin films. It also has been used as a fluorescence standard.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 3-4.10 |
| TSCA | TSCA listed |
| HS Code | 32041900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







