PRODUCT Properties
| Melting point: | -67 °C (lit.) |
| Boiling point: | 46 °C (lit.) |
| Density | 0.933 g/mL at 25 °C |
| refractive index | n |
| Flash point: | 16 °F |
| storage temp. | 0-6°C |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| form | Oil |
| color | Colourless to Yellow |
| Stability: | Volatile |
| InChI | 1S/C4H11N/c1-4(2,3)5/h5H2,1-3H3/i1D3,2D3,3D3 |
| InChIKey | YBRBMKDOPFTVDT-GQALSZNTSA-N |
| SMILES | [2H]C([2H])([2H])C(N)(C([2H])([2H])[2H])C([2H])([2H])[2H] |
Description and Uses
tert-Butylamine is common reagent in pharmaceuticals syntheses. Used in the preparation of aminoBODIPY compounds for chemical analyses. Also it aids in the synthesis of benzylurea-based insecticides c ontaining amide and sulfonate groups. It has also been used in the synthesis of BPTES analogs, that act as glutaminase inhibitors, which can attenuate the growth of human lymphoma B cells. This is the labeled analog.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H302+H332-H314 |
| Precautionary statements | P210-P280-P301+P312-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | F,C |
| Risk Statements | 11-20/22-35 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3286 3/PG 2 |
| WGK Germany | 3 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Inhalation Acute Tox. 4 Oral Aquatic Chronic 3 Eye Dam. 1 Flam. Liq. 2 Skin Corr. 1A |








