S656678
1,1′-Azobis(cyclohexanecarbonitrile) , 98% , 2094-98-6
Synonym(s):
1,1′-Azobis(cyanocyclohexane);ACHN
CAS NO.：2094-98-6
Empirical Formula: C14H20N4
Molecular Weight: 244.34
MDL number: MFCD00046334
EINECS: 218-254-8
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 114-118 °C(lit.) |
| Boiling point: | 423.9±38.0 °C(Predicted) |
| Density | 1.13±0.1 g/cm3(Predicted) |
| vapor pressure | 0-0.001Pa at 20-25℃ |
| storage temp. | 2-8°C |
| form | Solid:crystalline |
| BRN | 960744 |
| Stability: | Stable, but decomposes exothermically above about 114 C |
| InChI | 1S/C14H20N4/c15-11-13(7-3-1-4-8-13)17-18-14(12-16)9-5-2-6-10-14/h1-10H2/b18-17+ |
| InChIKey | KYIKRXIYLAGAKQ-ISLYRVAYSA-N |
| SMILES | N#CC1(CCCCC1)\N=N\C2(CCCCC2)C#N |
| LogP | 3.256 at 25℃ and pH5-6 |
| CAS DataBase Reference | 2094-98-6(CAS DataBase Reference) |
| EPA Substance Registry System | 1,1'-Azobiscyclohexanecarbonitrile (2094-98-6) |
Description and Uses
A more efficient radical initiator than AIBN has been employed to initiate primary radical reactions.
Safety
| Symbol(GHS) |    GHS02,GHS07,GHS09 |
| Signal word | Danger |
| Hazard statements | H242-H332-H335-H411 |
| Precautionary statements | P210-P234-P235-P240-P280-P261-P271-P273-P370+P378-P304+P340-P312-P391-P403-P411-P420-P403+P233-P405-P501 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | F,Xi |
| Risk Statements | 11-36/37/38 |
| Safety Statements | 26 |
| RIDADR | UN 3226 4.1 |
| WGK Germany | 3 |
| F | 4.9 |
| TSCA | TSCA listed |
| HazardClass | 4.1 |
| PackingGroup | II |
| Storage Class | 5.2 - Organic peroxides and self-reacting hazardous materials |
| Hazard Classifications | Eye Irrit. 2 Self-react. D Skin Irrit. 2 STOT SE 3 |
| REACH Registrations | Active |
| Limited Quantities | 1.0 Kg (2.2 lbs) |
| Excepted Quantities | Not Permitted as Excepted Quantity |
