S657279
≥98.0%(NT) , 17885-08-4
Synonym(s):
DL -2-Amino-3-hydroxypropanoic acid 3-phosphate;DL -Serine monophosphoric acid;DL -SOP
CAS NO.:17885-08-4
Empirical Formula: C3H8NO6P
Molecular Weight: 185.07
MDL number: MFCD00065935
EINECS: 241-834-7
| Pack Size | Price | Stock | Quantity |
| 10g | RMB797.23 | In Stock |
|
| 50g | RMB1819.34 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 190 °C(lit.) |
| Boiling point: | 475.4±55.0 °C(Predicted) |
| Density | 1.809 |
| storage temp. | -15°C |
| solubility | H2O: 50 mg/mL hot, clear, colorless to slightly yellow |
| form | Solid |
| pka | 1.71±0.10(Predicted) |
| color | White to Off-White |
| Merck | 7363 |
| BRN | 1726828 |
| InChI | InChI=1S/C3H8NO6P/c4-2(3(5)6)1-10-11(7,8)9/h2H,1,4H2,(H,5,6)(H2,7,8,9)/t2-/m0/s1 |
| InChIKey | BZQFBWGGLXLEPQ-REOHCLBHSA-N |
| SMILES | C(O)(=O)[C@H](COP(O)(O)=O)N |
| CAS DataBase Reference | 17885-08-4(CAS DataBase Reference) |
Description and Uses
DL-O-Phosphoserine is used in alternative pathways for biosynthesis of cysteine and of selenocysteine.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| F | 10 |







