S7502758
99% , 22813-31-6
CAS NO.:22813-31-6
Empirical Formula: C6H7N3O4
Molecular Weight: 185.14
MDL number: MFCD00192308
EINECS: 245-243-5
| Pack Size | Price | Stock | Quantity |
| 500MG | RMB1977.61 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 95-97 °C (lit.) |
| Boiling point: | 372.4±44.0 °C(Predicted) |
| Density | 1.48±0.1 g/cm3(Predicted) |
| storage temp. | Refrigerator |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| pka | 0.30±0.31(Predicted) |
| form | Solid |
| color | Pale Yellow |
| InChI | 1S/C6H7N3O4/c1-13-5(10)4-8-3-2-7-6(8)9(11)12/h2-3H,4H2,1H3 |
| InChIKey | KXEHVMQCOHOQHB-UHFFFAOYSA-N |
| SMILES | COC(=O)Cn1ccnc1[N+]([O-])=O |
Description and Uses
2-Nitro-1H-imidazole-1-acetic Acid Methyl Ester is an intermediate in the synthesis Benznidazole (B197927), is a labelled analogue of Benznidazole (B197925).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |



