S777278
DBE dibasic ester , 95481-62-2
Synonym(s):
DBE;Dibasic ester mixture;Imsol
| Pack Size | Price | Stock | Quantity |
| 1l | RMB351.54 | In Stock |
|
| 4l | RMB1038.93 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -20°C |
| Boiling point: | 196-225 °C(lit.) |
| Density | 1.19 g/mL at 25 °C(lit.) |
| vapor pressure | 0.2 mm Hg ( 20 °C) |
| refractive index | n |
| Flash point: | 212 °F |
| storage temp. | Store below +30°C. |
| form | liquid |
| explosive limit | 8% |
| Water Solubility | 53g/L |
| InChI | InChI=1S/C8H14O4.C7H12O4.C6H10O4/c1-11-7(9)5-3-4-6-8(10)12-2;1-10-6(8)4-3-5-7(9)11-2;1-9-5(7)3-4-6(8)10-2/h3-6H2,1-2H3;3-5H2,1-2H3;3-4H2,1-2H3 |
| InChIKey | QYMFNZIUDRQRSA-UHFFFAOYSA-N |
| SMILES | C(=O)(OC)CCC(=O)OC.C(C(=O)OC)CCCC(=O)OC.C(C(=O)OC)CCC(=O)OC |
| EPA Substance Registry System | Hexanedioic acid, dimethyl ester, mixt. with dimethyl butanedioate and dimethyl pentanedioate (95481-62-2) |
Description and Uses
Dibasic ester was commonly used as lubricants, solvents, plasticizers, additives, and spin finishes. It acts as a coating agent for magnet and enamel wires, magnetic memory discs, automobiles, coils, cans, sheets, industrial paint, et cetera.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P330-P501 |
| Hazard Codes | Xi,E |
| Risk Statements | 38-41-36-36/37/38-3 |
| Safety Statements | 26-36-39-35 |
| RIDADR | UN 3265 8/PG 3 |
| WGK Germany | 3 |
| Autoignition Temperature | 698 °F |
| HS Code | 3824 99 92 |





