S7951451
100?μg/mLinmethanol,ampuleof1?mL,certifiedreferencematerial,Cerilliant? , 132183-78-9
CAS NO.：132183-78-9
Empirical Formula: C15H2D10N2O
Molecular Weight: 246.33
MDL number: MFCD01073507
EINECS: 690-797-7
| Pack Size | Price | Stock | Quantity |
| 1ML | RMB1499.67 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Flash point: | 9℃ |
| storage temp. | -20°C |
| solubility | Acetone (Slightly, Sonicated), Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| color | White to Pale Yellow |
| Major Application | clinical testing |
| InChI | InChI=1S/C15H12N2O/c16-15(18)17-13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)17/h1-10H,(H2,16,18)/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D |
| InChIKey | FFGPTBGBLSHEPO-LHNTUAQVSA-N |
| SMILES | C12C([2H])=C(C([2H])=C([2H])C=1C([2H])=C([2H])C1C([2H])=C([2H])C([2H])=C([2H])C=1N2C(=O)N)[2H] |
| EPA Substance Registry System | 5H-Dibenz[b,f]azepine-1,2,3,4,6,7,8,9,10,11-d10-5-carboxamide (132183-78-9) |
Description and Uses
Carbamazepine-D10 is used to study occurrence of emerging trace organic chemicals in wastewater effluents in Saudi Arabia.
Safety
| Symbol(GHS) |    GHS02,GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H225-H301+H311+H331-H370 |
| Precautionary statements | P210-P260-P280-P301+P310-P311 |
| target organs | Eyes,Central nervous system |
| Hazard Codes | F,T |
| Risk Statements | 11-23/24/25-39/23/24/25 |
| Safety Statements | 7-16-36/37-45 |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution |
| WGK Germany | 1 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 |
