S8086251
1 mg/mLinmethanol,certifiedreferencematerial,ampuleof1 mL,Cerilliant , 1279037-95-4
CAS NO.:1279037-95-4
Empirical Formula: C12H21NO8S
Molecular Weight: 339.362
MDL number: MFCD09752150
EINECS: 802-954-0
| Pack Size | Price | Stock | Quantity |
| 1ML | RMB13624.83 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 125-126°C |
| Flash point: | 9℃ |
| storage temp. | -20°C Freezer |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Solid |
| color | White-to-Off-White |
| Major Application | clinical testing |
| InChI | 1S/C12H21NO8S/c1-10(2)18-7-5-16-12(6-17-22(13,14)15)9(8(7)19-10)20-11(3,4)21-12/h7-9H,5-6H2,1-4H3,(H2,13,14,15)/t7,8,9-,12-/m0/s1/i1D3,2D3,3D3,4D3 |
| InChIKey | KJADKKWYZYXHBB-FTZSVORRSA-N |
| SMILES | [2H]C([2H])([2H])C1(O[C@H]2CO[C@@]3(COS(N)(=O)=O)OC(O[C@H]3[C@H]2O1)(C([2H])([2H])[2H])C([2H])([2H])[2H])C([2H])([2H])[2H] |
Description and Uses
(Topiramate-d12) Labeled Topiramate, intended for use as an internal standard for the quantification of Topiramateby GC- or LC-mass spectrometry.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H225-H301+H311+H331-H370 |
| Precautionary statements | P210-P260-P280-P301+P310-P311 |
| target organs | Eyes |
| Hazard Codes | F,T |
| Risk Statements | 11-23/24/25-39/23/24/25 |
| Safety Statements | 7-16-36/37-45 |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution |
| WGK Germany | 1 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 |





