PRODUCT Properties
| Melting point: | 235-237 °C |
| Boiling point: | 776.8±60.0 °C(Predicted) |
| Density | 1.373±0.06 g/cm3(Predicted) |
| storage temp. | -20°C |
| pka | 9.87±0.15(Predicted) |
| form | powder |
| color | white |
| InChI | 1S/C22H19N3O5/c26-19-12-6-15(7-13-19)14-20(24-21(27)16-4-2-1-3-5-16)22(28)23-17-8-10-18(11-9-17)25(29)30/h1-13,20,26H,14H2,(H,23,28)(H,24,27) |
| InChIKey | CJERUMAUMMIPRF-UHFFFAOYSA-N |
| SMILES | Oc1ccc(CC(NC(=O)c2ccccc2)C(=O)Nc3ccc(cc3)[N+]([O-])=O)cc1 |
Description and Uses
N-Benzoyl-L-tyrosine p-nitroanilide (BTPNA) is used as a substrate to identify, differentiate and characterize serine carboxypeptidase(s) and various proteases.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
