PRODUCT Properties
| Melting point: | 9.63°C (estimate) |
| Boiling point: | 135 °C0.4 mm Hg(lit.) |
| Density | 0.906 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Amber Vial, Refrigerator |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Oil |
| pka | 4.77±0.10(Predicted) |
| color | Colourless |
| Stability: | Light Sensitive |
| InChI | 1S/C12H22O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h7-8H,2-6,9-11H2,1H3,(H,13,14)/b8-7- |
| InChIKey | IJBFSOLHRKELLR-FPLPWBNLSA-N |
| SMILES | [H]\C(CCCCCC)=C(/[H])CCCC(O)=O |
Description and Uses
(5Z)-5-Dodecenoic acid is a fatty acid and a component of the essential oils of certain plants, such as Paeonia lactiflora Pall., and is used as biofuel.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 23-26-27-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |






