S8906214
5-(N,N-Dimethyl)amiloride hydrochloride , 1214-79-5
Synonym(s):
3-Amino-N-(aminoiminoethyl)-5-(dimethylamino)-6-chloropyrazinecarboxamide hydrochloride;DMA
| Pack Size | Price | Stock | Quantity |
| 25mg | RMB2059.50 | In Stock |
|
| 100mg | RMB6906.85 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 216-217 °C |
| Density | 1.68±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | Yellow solid. |
| pka | 8.66±0.46(Predicted) |
| color | Light yellow to yellow |
| InChI | 1S/C8H12ClN7O.ClH/c1-16(2)6-4(9)13-3(5(10)14-6)7(17)15-8(11)12;/h1-2H3,(H2,10,14)(H4,11,12,15,17);1H |
| InChIKey | IIUPTHVVXMBJMQ-UHFFFAOYSA-N |
| SMILES | Cl.CN(C)c1nc(N)c(nc1Cl)C(=O)\N=C(\N)N |
Description and Uses
5-(N,N-Dimethyl)amiloride hydrochloride is a selective blocker of Na2/H+ antiport. 5-(N,N-Dimethyl)amiloride hydrochloride has been investigated for its ability to reduce inflammatory pain.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 2811 |
| WGK Germany | - |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







