S8917314
≥98%(HPLC) , 99196-74-4
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB783.23 | In Stock |
|
| 25mg | RMB2895.77 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 563.1±50.0 °C(Predicted) |
| Density | 1.178±0.06 g/cm3(Predicted) |
| storage temp. | room temp |
| solubility | DMSO: ≥20mg/mL |
| form | powder |
| pka | 3.46±0.36(Predicted) |
| color | white to off-white |
| InChI | 1S/C21H23NO3/c1-2-3-4-7-16-10-12-17(13-11-16)14-15-20(23)22-19-9-6-5-8-18(19)21(24)25/h5-6,8-15H,2-4,7H2,1H3,(H,22,23)(H,24,25)/b15-14+ |
| InChIKey | GAMRBCZMOOMBSQ-CCEZHUSRSA-N |
| SMILES | CCCCCc1ccc(\C=C\C(=O)Nc2ccccc2C(O)=O)cc1 |
Description and Uses
N-(p-Amylcinnamoyl)anthranilic acid has been used as a transient receptor potential cation channel subfamily M member 2 (TRPM2) inhibitor, in studying its role in regulating the production of reactive oxygen species (ROS).
