S8929314
≥95% , 102418-74-6
Synonym(s):
N-(+)-Biotinyl-4-aminobenzoic acid sodium salt;N-Biotinyl-p-aminobenzoic acid sodium salt;Sodium N-(+)-biotinyl-4-aminobenzoate
CAS NO.：102418-74-6
Empirical Formula: C17H20N3NaO4S
Molecular Weight: 385.41
MDL number: MFCD00063374
| Pack Size | Price | Stock | Quantity |
| 10mg | RMB550.28 | In Stock |
|
| 50mg | RMB1748.34 | In Stock |
|
| 100mg | RMB2999.83 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300°C (dec.) |
| storage temp. | 2-8°C |
| solubility | Aqueous Base (Slightly), DMSO (Slightly, Heated) |
| form | Solid |
| color | Off-White to Pale Yellow |
| Stability: | Hygroscopic |
| InChIKey | AMXZKFYBAOWERX-HZPCBCDKSA-M |
| SMILES | [Na+].[H][C@]12CS[C@@H](CCCCC(=O)Nc3ccc(cc3)C([O-])=O)[C@@]1([H])NC(=O)N2 |
Description and Uses
(+)-Biotin 4-Amidobenzoic Acid, Sodium Salt is a fluorigenic substrate for the determination of Biotinidase activity.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338-P330-P332+P313-P337+P313-P362-P403+P233-P405-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 10 |
| Storage Class | 11 - Combustible Solids |
