S8964614
≥98%(HPLC),solid , 81166-47-4
| Pack Size | Price | Stock | Quantity |
| 10mg | RMB2789.72 | In Stock |
|
| 50mg | RMB11180.26 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 173-174 °C |
| Boiling point: | 562.2±50.0 °C(Predicted) |
| Density | 1.307±0.06 g/cm3(Predicted) |
| solubility | H2O: insoluble <0.11mg/mL |
| form | solid |
| pka | 2.80±0.10(Predicted) |
| color | white |
| optical activity | [α]27/D +18.1°, c = 0.7 in methanol(lit.) |
| Water Solubility | H2O: insoluble <0.11mg/mL DMSO: >20mg/mL 0.1 M HCl: insoluble 0.1 M NaOH: soluble ethanol: soluble |
| InChI | 1S/C20H24Cl2O4/c1-2-3-8-20(13-6-4-5-7-13)10-12-9-14(26-11-15(23)24)17(21)18(22)16(12)19(20)25/h9,13H,2-8,10-11H2,1H3,(H,23,24)/t20-/m0/s1 |
| InChIKey | YAWWQIFONIPBKT-FQEVSTJZSA-N |
| SMILES | CCCC[C@]1(Cc2cc(OCC(O)=O)c(Cl)c(Cl)c2C1=O)C3CCCC3 |
Description and Uses
R-(+)-DIOA is an inhibitor of the K+/Cl--cotransport that does not affect the bumetanide-Na+/K+/Cl--cotransport system.
Safety
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
