S9029614
BioReagent,suitableforplantcellculture,liquid , 77026-92-7
Synonym(s):
(±)-1α,2β-3-Oxo-2-(cis-2-pentenyl)cyclopentaneacetic acid
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB985.36 | In Stock |
|
| 250mg | RMB2081.01 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 160C |
| Density | 1.07 |
| storage temp. | 2-8°C |
| solubility | DMF: >25 mg/ml (from Cucurbic Acid); DMSO: >16 mg/ml (from Cucurbic Acid); Ethanol: >30 mg/ml (from Cucurbic Acid); PBS pH 7.2: >3 mg/ml (from Cucurbic Acid) |
| form | Liquid |
| pka | 4.52±0.10(Predicted) |
| color | Colorless to light yellow |
| Merck | 5260 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | InChI=1/C12H18O3/c1-2-3-4-5-10-9(8-12(14)15)6-7-11(10)13/h3-4,9-10H,2,5-8H2,1H3,(H,14,15)/b4-3-/t9-,10-/s3 |
| InChIKey | ZNJFBWYDHIGLCU-XDYKBSRKNA-N |
| SMILES | [C@H]1(CC(O)=O)CCC(=O)[C@@H]1C/C=C\CC |&1:0,9,r| |
Description and Uses
Jasmonic acid (JA) is a plant hormone derived from linolenic acid. Jasmonic acid is involved in plant cell signaling responses to abiotic and biotic stress. JA is involved in the regulation of processes that include growth inhibition, senescence, flower development, leaf abscission and tendril coiling. JA is also involved in wound healing of plants and systemic acquired resistance to attack by insects.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H319 |
| Precautionary statements | P210-P233-P240-P241-P242-P243-P264-P280-P303+P361+P353-P305+P351+P338-P337+P313-P370+P378-P403+P235-P501 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |








