S9073314
≥98%(HPLC) , 101622-51-9
Synonym(s):
2-(Hydroxyethylamino)-6-benzylamino-9-methylpurine;Olomoucine;Olomoucine - CAS 101622-51-9 - Calbiochem
| Pack Size | Price | Stock | Quantity |
| 1mg | RMB819.52 | In Stock |
|
| 5mg | RMB2358.10 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 120-130 °C |
| Boiling point: | 579.6±60.0 °C(Predicted) |
| Density | 1.36 |
| storage temp. | -20°C |
| solubility | DMSO, Methanol (Slightly) |
| form | Solid |
| pka | 14.55±0.10(Predicted) |
| color | White to off-white |
| InChI | 1S/C15H18N6O/c1-21-10-18-12-13(17-9-11-5-3-2-4-6-11)19-15(16-7-8-22)20-14(12)21/h2-6,10,22H,7-9H2,1H3,(H2,16,17,19,20) |
| InChIKey | GTVPOLSIJWJJNY-UHFFFAOYSA-N |
| SMILES | Cn1cnc2c(NCc3ccccc3)nc(NCCO)nc12 |
| CAS DataBase Reference | 101622-51-9(CAS DataBase Reference) |
Description and Uses
A purine derivative which inhibits cyclin-dependent kinases and induces G1 arrest.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29339980 |
| Storage Class | 11 - Combustible Solids |






