S907377
cis-Pinonic acid , 98% , 61826-55-9
Synonym(s):
cis-3-Acetyl-2,2-dimethylcyclobutaneacetic acid
| Pack Size | Price | Stock | Quantity |
| 5g | RMB938.55 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 104-107 °C (lit.) |
| Boiling point: | 258.19°C (rough estimate) |
| Density | 1.0655 (rough estimate) |
| refractive index | 1.5230 (estimate) |
| pka | 4.72±0.10(Predicted) |
| form | solid |
| InChI | 1S/C10H16O3/c1-6(11)8-4-7(5-9(12)13)10(8,2)3/h7-8H,4-5H2,1-3H3,(H,12,13)/t7-,8+/m1/s1 |
| InChIKey | SIZDUQQDBXJXLQ-SFYZADRCSA-N |
| SMILES | CC(=O)[C@@H]1C[C@H](CC(O)=O)C1(C)C |
| EPA Substance Registry System | Cyclobutaneacetic acid, 3-acetyl-2,2-dimethyl-, (1R,3R)-rel- (61826-55-9) |
Description and Uses
cis-Pinonic acid undergoes oxidation to produce secondary organic aerosol (SOA).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29183000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |



