S9091214
≥85% , 108321-21-7
Synonym(s):
n-Propionyl CoA lithium salt
CAS NO.：108321-21-7
Empirical Formula: C24H39LiN7O17P3S
Molecular Weight: 829.53
MDL number: MFCD00079248
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB1776.35 | In Stock |
|
| 10mg | RMB3043.77 | In Stock |
|
| 25mg | RMB6074.88 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >186°C (dec.) |
| storage temp. | -20°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| color | White to Off-White |
| biological source | yeast |
| Water Solubility | H2O: soluble-50mg/mL, clear, colorless |
| Stability: | Hygroscopic |
| InChIKey | CXNLEKKSVXVZAF-IEQRABFGSA-N |
| SMILES | [Li].[P](=O)(O[P](=O)(OCC([C@@H](O)C(=O)NCCC(=O)NCCSC(=O)CC)(C)C)O)(OC[C@H]1O[C@H]([C@@H]([C@@H]1O[P](=O)(O)O)O)[n]2c3ncnc(c3nc2)N)O |
Description and Uses
Propionyl Coenzyme A Lithium Salt is a nucleotide used in various biochemical assays such in the structural and enzymatic study of YbgC proteins.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-26-36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
