S9110514
756526-04-2
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB1603.99 | In Stock |
|
| 1000mg | RMB3196.32 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 547.1±50.0 °C(Predicted) |
| Density | 1.128±0.06 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | Soluble in Water, DMSO, DCM, DMF |
| pka | 4.28±0.10(Predicted) |
| form | solid or viscous liquid |
| color | White to light yellow |
| InChI | InChI=1S/C19H39NO10/c20-2-4-24-6-8-26-10-12-28-14-16-30-18-17-29-15-13-27-11-9-25-7-5-23-3-1-19(21)22/h1-18,20H2,(H,21,22) |
| InChIKey | YLKOHZCQTVYVDB-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCN |
Description and Uses
Amino-PEG8-acid is a water soluble PEG linker consisting of an amino group (NH2) with a terminal carboxylic acid. The amine group is reactive with activated NHS esters, carbonyls (ketone, aldehyde) etc.
1-Amino-3,6,9,12,15,18,21,24-octaoxaheptacosan-27-oic Acid is used in targeted drug delivery as conjugate with carbon nanotubes. It is also used as linker for enzyme immobilization in optimization of bio-nano interface to enhance enzyme catalytic efficiency.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| WGK Germany | WGK 3 |
| HS Code | 2942000090 |
| Storage Class | 11 - Combustible Solids |






