S9112114
1214319-92-2
CAS NO.:1214319-92-2
Empirical Formula: C19H37N3O10
Molecular Weight: 467.511
MDL number: MFCD21363300
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB1436.88 | In Stock |
|
| 1000mg | RMB4785.66 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | -20°C |
| solubility | Soluble in Water, DMSO, DCM, DMF |
| form | solid or viscous liquid |
| color | Colorless to light yellow |
| InChI | 1S/C19H37N3O10/c20-22-21-2-4-26-6-8-28-10-12-30-14-16-32-18-17-31-15-13-29-11-9-27-7-5-25-3-1-19(23)24/h1-18H2,(H,23,24) |
| InChIKey | URUGOEBULOZLBF-UHFFFAOYSA-N |
| SMILES | OC(CCOCCOCCOCCOCCOCCOCCOCCOCCN=[N+]=[N-])=O |
Description and Uses
Azido-PEG8-acid is a aqueous soluble PEG linker containing an azide (N3) and a terminal carboxylic acid (CO2H) group. The azide group can react with alkyne, BCN, DBCO via Click Chemistry to yield a stable triazole linkage. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P302+P352-P304+P340-P305+P351+P338-P312-P321 |
| WGK Germany | WGK 3 |
| HS Code | 2929900090 |
| Storage Class | 11 - Combustible Solids |





