S9119314
solid,≥98%(HPLC) , 109544-45-8
Synonym(s):
2-[2-(2-Methoxy-1,4-benzodioxanyl)]imidazoline hydrochloride
CAS NO.：109544-45-8
Empirical Formula: C12H15ClN2O3
Molecular Weight: 270.71
MDL number: MFCD00069343
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB2453.90 | In Stock |
|
| 250mg | RMB9815.63 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | Desiccate at RT |
| solubility | H2O: >20mg/mL |
| form | solid |
| color | white |
| Water Solubility | H2O: >20mg/mL |
| InChI | 1S/C12H14N2O3.ClH/c1-15-12(11-13-6-7-14-11)8-16-9-4-2-3-5-10(9)17-12;/h2-5H,6-8H2,1H3,(H,13,14);1H |
| InChIKey | IMPOOMVZVWKSAP-UHFFFAOYSA-N |
| SMILES | Cl[H].COC1(COc2ccccc2O1)C3=NCCN3 |
Description and Uses
RX 821002 Hydrochloride is a selective and potent α2-adrenoceptor antagonist.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
