S9120714
117756-27-1
CAS NO.:117756-27-1
Empirical Formula: C34H43N5O10
Molecular Weight: 681.73
MDL number: MFCD00151397
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB1220.40 | In Stock |
|
| 25mg | RMB4686.34 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | -20°C |
| solubility | 1 M NH4OH: 50mg/mL, clear to slightly hazy, colorless to light yellow |
| form | powder |
| Sequence | Suc-Ala-Phe-Lys-AMC |
| InChIKey | YSFJDCMZVSMICC-FMQWQMCSSA-N |
| SMILES | CC(O)=O.C[C@H](NC(=O)CCC(O)=O)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCCN)C(=O)Nc2ccc3C(C)=CC(=O)Oc3c2 |
Description and Uses
Suc-AFK-AMC acetate is a marker for P. aeruginosa protease activity using cultured reference strains[1].
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335-H351 |
| Precautionary statements | P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338-P308+P313 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38-40 |
| Safety Statements | 22-26-36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Carc. 2 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |








