S912878
Methyl (2R)-glycidate , opticalpurityee:94%(GLC),97% , 111058-32-3
CAS NO.：111058-32-3
Empirical Formula: C4H6O3
Molecular Weight: 102.09
MDL number: MFCD00274191
EINECS: 601-036-5
| Pack Size | Price | Stock | Quantity |
| 5g | RMB1704.90 | In Stock |
|
| 25g | RMB4136.83 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| alpha | 32 º (c=1, chloroform) |
| Boiling point: | 97.4±15.0 °C(Predicted) |
| Density | 1.166 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 162 °F |
| storage temp. | 2-8°C |
| solubility | Acetonitrile (Slightly), Chloroform (Soluble), Ethyl Acetate (Slightly) |
| form | Oil |
| color | Colourless |
| optical activity | [α]20/D +32°, c = 1 in chloroform |
| Stability: | Volatile |
| InChI | InChI=1S/C4H6O3/c1-6-4(5)3-2-7-3/h3H,2H2,1H3/t3-/m1/s1 |
| InChIKey | YKNYRRVISWJDSR-GSVOUGTGSA-N |
| SMILES | O1C[C@@H]1C(OC)=O |
Description and Uses
(R)-Methyglycidate is used in the preparation of antibacterial oxazolidinones.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | NA 1993 / PGIII |
| WGK Germany | 3 |
| HS Code | 2910900090 |
