S9149714
Oxyphenbutazone , ≥98%(HPLC) , 129-20-4
Synonym(s):
4-Butyl-1-(4-hydroxyphenyl)-2-phenyl-3,5-pyrazolidinedione;p-Hydroxyphenylbutazone;p-Oxyphenylbutazone
CAS NO.：129-20-4
Empirical Formula: C19H20N2O3
Molecular Weight: 324.37
MDL number: MFCD00057278
EINECS: 204-936-2
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB4728.28 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 109-111°C |
| Boiling point: | 462.71°C (rough estimate) |
| Density | 1.2118 (rough estimate) |
| refractive index | 1.6140 (estimate) |
| storage temp. | -20°C |
| solubility | DMSO: soluble10mg/mL, clear |
| pka | pKa 4.7/10.0±0.2(H2O,t =25,Iundefined) (Uncertain) |
| form | powder |
| color | white to brown |
| Water Solubility | 20mg/L(room temperature) |
| Stability: | Hygroscopic |
| InChI | 1S/C19H20N2O3/c1-2-3-9-17-18(23)20(14-7-5-4-6-8-14)21(19(17)24)15-10-12-16(22)13-11-15/h4-8,10-13,17,22H,2-3,9H2,1H3 |
| InChIKey | HFHZKZSRXITVMK-UHFFFAOYSA-N |
| SMILES | N2(N(C(=O)C(C2=O)CCCC)c3ccccc3)c1ccc(cc1)O |
| CAS DataBase Reference | 129-20-4(CAS DataBase Reference) |
| IARC | 3 (Vol. 13, Sup 7) 1987 |
| EPA Substance Registry System | 3,5-Pyrazolidinedione, 4-butyl-1-(4-hydroxyphenyl)-2-phenyl- (129-20-4) |
Description and Uses
Anti-inflammatory;Cyclooxygenase inhibito
Safety
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H400 |
| Precautionary statements | P273-P301+P312+P330 |
| Hazard Codes | Xn,N |
| Risk Statements | 22-50 |
| Safety Statements | 61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 |
| Hazardous Substances Data | 129-20-4(Hazardous Substances Data) |
