S9182714
≥95%(HPLC) , 66635-93-6
Synonym(s):
(+)-Ketorolac;(1R)-5-Benzoyl-2,3-dihydro-1H-pyrrolizine-1-carboxylic acid;;(R)-(+)-ketorolac;(R)-Ketorolac
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB2346.01 | In Stock |
|
| 25mg | RMB9397.03 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 163-170°C |
| storage temp. | -20°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | powder |
| color | white to beige |
| optical activity | [α]/D +162 to +178°, c = 1 in methanol |
| InChI | 1S/C15H13NO3/c17-14(10-4-2-1-3-5-10)13-7-6-12-11(15(18)19)8-9-16(12)13/h1-7,11H,8-9H2,(H,18,19)/t11-/m1/s1 |
| InChIKey | OZWKMVRBQXNZKK-LLVKDONJSA-N |
| SMILES | O=C(O)[C@H]1C2=CC=C(C(C3=CC=CC=C3)=O)N2CC1 |
Description and Uses
(R)-Ketorolac is the R-enantiomer of Ketorolac. The (S)-enantiomer is about 60 times more potent than (R)-enantiomer. Prostaglandin biosynthesis inhibitor. Analgesic; anti-inflammatory.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P305+P351+P338 |
| target organs | Respiratory system |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
