S9216914
36455-72-8
Synonym(s):
2,4-Dihydroxy-6-(6α,10-dihydroxy-trans-1-undecenyl)benzoic acid μ-lactone;2,4-Dihydroxy-6-(6α,10-dihydroxy-trans-1-undecenyl)benzoic acid μ-lactone solution
CAS NO.:36455-72-8
Empirical Formula: C18H24O5
Molecular Weight: 320.38
MDL number: MFCD16657008
EINECS: 828-728-1
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB3340.41 | In Stock |
|
| 10mg | RMB6176.63 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 158-161°C |
| Boiling point: | 599.0±50.0 °C(Predicted) |
| Density | 1.174±0.06 g/cm3(Predicted) |
| Flash point: | 2℃ |
| storage temp. | -20°C |
| solubility | ≤20mg/ml in ethanol;30mg/ml in DMSO;30mg/ml in dimethyl formamide |
| form | crystalline solid |
| pka | 7.61±0.60(Predicted) |
| color | White to off-white |
| Stability: | Hygroscopic |
| Major Application | cleaning products cosmetics food and beverages personal care |
| InChI | InChI=1S/C18H24O5/c1-12-6-5-9-14(19)8-4-2-3-7-13-10-15(20)11-16(21)17(13)18(22)23-12/h3,7,10-12,14,19-21H,2,4-6,8-9H2,1H3/b7-3+/t12-,14+/m0/s1 |
| InChIKey | FPQFYIAXQDXNOR-QDKLYSGJSA-N |
| SMILES | O1C(=O)C2=C(O)C=C(O)C=C2C=CCCC[C@@H](O)CCC[C@@H]1C |t:12| |
Description and Uses
α-Zearalenol is a major hepatic metabolite of zearalenone , a mycotoxin produced by fungi in food and animal feeds. It is a less potent agonist of estrogen receptors than the parent compound. However, α-zearalenol has pronounced effects on uterotropic activity, sperm motility, and preimplantation embryonic development.
The major metabolites of Zearalenone
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS08 |
| Signal word | Danger |
| Hazard statements | H314-H351-H361fd-H371-H412 |
| Precautionary statements | P260-P273-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | Xn,T,F |
| Risk Statements | 20/21/22-40-52/53-68/20/21/22-36-11-62-48/20-63-46-45 |
| Safety Statements | 36/37-61-16-45-53 |
| RIDADR | UN 1648 3 / PGII |
| WGK Germany | 3 |
| F | 8 |
| HS Code | 29322090 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 2 |






