S923679
cis-4,7,10,13,16,19-Docosahexaenoic acid methyl ester , ≥98% , 2566-90-7
| Pack Size | Price | Stock | Quantity |
| 10mg | RMB606.70 | In Stock |
|
| 50mg | RMB1764.18 | In Stock |
|
| 100mg | RMB3033.41 | In Stock |
|
| 1g | RMB14615.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 429.9±24.0 °C(Predicted) |
| Density | 0.921 g/mL at 25 °C(lit.) |
| refractive index | 1.4959 (589.3 nm 20℃) |
| Flash point: | 18 °C |
| storage temp. | -20°C |
| solubility | DMF: 100 mg/ml; DMSO: 100 mg/ml; Ethanol: 100 mg/ml; PBS (pH 7.2): .15 mg/ml |
| form | Oil |
| color | Colourless |
| biological source | synthetic (organic) |
| Stability: | Hygroscopic |
| InChIKey | VCDLWFYODNTQOT-JDPCYWKWSA-N |
| SMILES | CC\C=C/C\C=C/C\C=C/C\C=C/C\C=C/C\C=C/CCC(=O)OC |
Description and Uses
Docosahexaenoic Acid methyl ester is a type of biodiesel with industrial applications. Used as a reagent in cholesterol photooxidation.
Safety
| Symbol(GHS) | ![]() GHS02 |
| Signal word | Danger |
| Hazard statements | H225 |
| Precautionary statements | P210-P233-P240-P241-P242-P243-P280-P303+P361+P353-P370+P378-P403+P235-P501 |
| PPE | Eyeshields, Gloves |
| Hazard Codes | F,N,Xn |
| Risk Statements | 11-67-65-50/53-38 |
| Safety Statements | 16-62-61-24/25 |
| RIDADR | UN1170 3/PG 2 |
| WGK Germany | 3 |
| F | 10-23 |
| HS Code | 29161900 |
| Storage Class | 10 - Combustible liquids |



