S928378
Poly(butyl methacrylate-co-methyl methacrylate) , averageMw~150,000 , 25608-33-7
Synonym(s):
Poly(butyl methacrylate-co-methyl methacrylate)
| Pack Size | Price | Stock | Quantity |
| 250g | RMB863.58 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Density | 1.15 g/mL at 25 °C(lit.) |
| refractive index | n/D 1.490-1.500 |
| Flash point: | 23 °C |
| storage temp. | room temp |
| solubility | alcohols and aliphatic hydrocarbons: insoluble |
| form | solid |
| color | yellow |
| Water Solubility | water: insoluble |
| InChI | InChI=1S/C8H14O2.C5H8O2/c1-4-5-6-10-8(9)7(2)3;1-4(2)5(6)7-3/h2,4-6H2,1,3H3;1H2,2-3H3 |
| InChIKey | WHLPIOPUASGRQN-UHFFFAOYSA-N |
| SMILES | C(=O)(OC)C(=C)C.C(=O)(C(=C)C)OCCCC |
| Surface tension | 31.2mN/m at 20°C |
| EPA Substance Registry System | Butyl methacrylate methyl methacrylate polymer (25608-33-7) |
Description and Uses
Binding agent for printing inks and foil, hardboard and ceramic lacquers.
Safety
| Symbol(GHS) |    GHS02,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H226-H304-H315-H319-H335-H373-H412 |
| Precautionary statements | P210-P273-P301+P310-P303+P361+P353-P314-P331 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn |
| Risk Statements | 10-20/21-38 |
| Safety Statements | 25-36/37 |
| RIDADR | UN 1307 3/PG 3 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| Storage Class | 11 - Combustible Solids |
