S936879
Dihydrofolic acid , ≥90% , 4033-27-6
Synonym(s):
7,8-Dihydropteroyl-L -glutamic acid;Dihydropteroyl-L -glutamic acid;FAH2
| Pack Size | Price | Stock | Quantity |
| 10mg | RMB947.98 | In Stock |
|
| 25mg | RMB2003.97 | In Stock |
|
| 100mg | RMB6707.82 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >160°C (dec.) |
| Density | 1.69±0.1 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | 0.1 M NaOH: 10 mg/mL, slightly hazy, orange |
| pka | pKa 1.38(H2O t=25 I=0.10) (Occasionally);3.84(H2O t=25 I=0.10) (Occasionally) |
| form | Solid |
| color | Light Beige to Beige |
| biological source | synthetic (organic) |
| BRN | 69017 |
| Stability: | Air Sensitive, Hygroscopic, Temperature Sensitive |
| InChIKey | OZRNSSUDZOLUSN-LBPRGKRZSA-N |
| SMILES | NC1=NC(=O)C2=C(NCC(CNc3ccc(cc3)C(=O)N[C@@H](CCC(O)=O)C(O)=O)=N2)N1 |
Description and Uses
antidote to methotrexate toxicity
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




