PRODUCT Properties
| Melting point: | -114℃ |
| Boiling point: | 94 °C (lit.) |
| Density | 0.744 g/mL at 25 °C (lit.) |
| vapor pressure | 67 mm Hg ( 37.7 °C) |
| refractive index | n |
| Flash point: | 50 °F |
| storage temp. | Flammables area |
| form | Liquid |
| color | Clear colorless to light yellow |
| InChI | InChI=1S/C7H12/c1-6(2)5-7(3)4/h5H,1H2,2-4H3 |
| InChIKey | CMSUNVGIWAFNBG-UHFFFAOYSA-N |
| SMILES | C=C(C)/C=C(\C)/C |
| CAS DataBase Reference | 1000-86-8 |
Description and Uses
2,4-Dimethyl-1,3-pentadiene has been used to study the structure of its various conformational isomers and their vibrational spectra.
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| Hazard Codes | F,Xi |
| Risk Statements | 11-36/37/38 |
| Safety Statements | 16-26-36/37/39 |
| RIDADR | UN 3295 3/PG 2 |
| WGK Germany | 3 |
| HazardClass | 3.1 |
| PackingGroup | II |
| HS Code | 29012900 |
| Limited Quantities | 1.0 L (0.3 gallon) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
