S9503248
affinityisolatedantibody,bufferedaqueoussolution
| Pack Size | Price | Stock | Quantity |
| 100μG | RMB3465.74 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 459.9±45.0 °C(Predicted) |
| Density | 1.30±0.1 g/cm3(Predicted) |
| storage temp. | −20°C |
| form | liquid |
| pka | 9.09±0.10(Predicted) |
| Major Application | forensics and toxicology |
| InChI | 1S/C17H21NO5/c1-18-11-6-7-13(18)15(17(21)22-2)14(9-11)23-16(20)10-4-3-5-12(19)8-10/h3-5,8,11,13-15,19H,6-7,9H2,1-2H3/t11?,13-,14?,15?/m1/s1 |
| InChIKey | IQXBUEUAOWARGT-QZMFJGEPSA-N |
| SMILES | N1([C@H]2C(C(CC1CC2)OC(=O)c3cc(ccc3)O)C(=O)OC)C |
Description and Uses
m-Hydroxycocaine is a metabolite of Cocaine (HCl: C633500), a vasoconstrictive agent that is highly addictive and has high potential for abuse. The mechanism by which Cocaine induces dependence is unknown, but it is hypothesized that it works by blocking the dopamine transporter, increasing the amount of free dopamine in the brain.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H312-H317-H332 |
| Precautionary statements | P280 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-43 |
| Safety Statements | 22-26-36/37/39 |
| RIDADR | UN 1544 6.1/PG 2 |
| WGK Germany | 3 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 2 |





