PRODUCT Properties
| Melting point: | 211-213 °C (dec.)(lit.) |
| Boiling point: | 416.8±35.0 °C(Predicted) |
| Density | 1.478±0.06 g/cm3(Predicted) |
| storage temp. | Storage temp. 2-8°C |
| solubility | ethanol: 50 mg/mL |
| pka | 4.58±0.10(Predicted) |
| form | powder |
| color | yellow to tan |
| BRN | 1954563 |
| Major Application | food and beverages |
| InChI | 1S/C9H8O4/c10-7-3-1-6(5-8(7)11)2-4-9(12)13/h1-5,10-11H,(H,12,13)/b4-2+ |
| InChIKey | QAIPRVGONGVQAS-DUXPYHPUSA-N |
| SMILES | OC(=O)\C=C\c1ccc(O)c(O)c1 |
| LogP | 1.420 (est) |
| CAS DataBase Reference | 501-16-6(CAS DataBase Reference) |
Description and Uses
trans-Caffeic Acid is a useful synthetic intermediate. It was used as a reactant to synthesize N-caffeoylphenalkylamide derivatives as bacterial efflux pump inhibitors. It is also used to prepare caffeic acid phenethyl ester analogs with antitumor structures.
Safety
| Symbol(GHS) |  GHS08 |
| Signal word | Warning |
| Hazard statements | H351 |
| Precautionary statements | P201-P308+P313 |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-40-63-68-36 |
| Safety Statements | 26-36/37/39-36/37 |
| WGK Germany | 3 |
| RTECS | GD8950000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Carc. 2 |
