S9541148
FastGarnetGBCsulfatesalt , diazoniumdye , 101-89-3
Synonym(s):
2-Methyl-4-([2-methylphenyl]azo)benzenediazonium salt;4-Amino-2′,3-dimethylazobenzene diazotated;Azoic Diazo No. 4
CAS NO.：101-89-3
Empirical Formula: C14H14N4O4S
Molecular Weight: 334.35
MDL number:
EINECS: 202-985-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB393.63 | In Stock |
|
| 5g | RMB1349.07 | In Stock |
|
| 25g | RMB4759.48 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >110°C (dec.) |
| Density | 1.3798 (rough estimate) |
| refractive index | 1.6270 (estimate) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| Colour Index | 37210 |
| form | Solid |
| color | Red brown |
| Water Solubility | 7.64 mg/L @ 25°C |
| Stability: | Hygroscopic, Light Sensitive |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C14H13N4.H2O4S/c1-10-5-3-4-6-14(10)18-17-12-7-8-13(16-15)11(2)9-12;1-5(2,3)4/h3-9H,1-2H3;(H2,1,2,3,4)/q+1;/p-1 |
| InChIKey | PPTXFSQSISUDAU-UHFFFAOYSA-M |
| SMILES | OS([O-])(=O)=O.Cc1ccccc1N=Nc2ccc([N+]#N)c(C)c2 |
| CAS DataBase Reference | 101-89-3 |
Description and Uses
Fast Garnet GBC Salt can be used to target cell staining test kit for testing cell proliferation activity.
Safety
| Symbol(GHS) |  GHS08 |
| Signal word | Danger |
| Hazard statements | H350 |
| Precautionary statements | P201-P308+P313 |
| PPE | Eyeshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Statements | 45-61-20/21/22 |
| Safety Statements | 53-45-36/37/39 |
| WGK Germany | 3 |
| F | 8 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Carc. 1B |
