S9546048
Tetrahydrofuran , EMPLURA , 109-99-9
CAS NO.：109-99-9
Empirical Formula: C21H19ClD4FNO2
Molecular Weight: 379.89
MDL number: MFCD00673279
EINECS: 802-960-3
| Pack Size | Price | Stock | Quantity |
| 1L | RMB357.83 | In Stock |
|
| 2.5L | RMB745.48 | In Stock |
|
| 25L | RMB4334.27 | In Stock |
|
| 190L | RMB28028.29 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 148-1500C |
| Flash point: | 9℃ |
| storage temp. | -20°C |
| form | Solid |
| color | White to off-white |
| Major Application | clinical testing |
| InChI | 1S/C21H23ClFNO2/c22-18-7-5-17(6-8-18)21(26)11-14-24(15-12-21)13-1-2-20(25)16-3-9-19(23)10-4-16/h3-10,26H,1-2,11-15H2/i3D,4D,9D,10D |
| InChIKey | LNEPOXFFQSENCJ-AKPGVGPLSA-N |
| SMILES | FC1=C([2H])C([2H])=C(C(CCCN2CCC(O)(C3=CC=C(Cl)C=C3)CC2)=O)C([2H])=C1[2H] |
Description and Uses
Labeled HALOPERIDOL-D4, intended for use as an internal standard for the quantification of Haloperidol by GC- or LC-mass spectrometry.
Safety
| Symbol(GHS) |    GHS02,GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H225-H301+H311+H331-H370 |
| Precautionary statements | P210-P260-P280-P301+P310-P311 |
| target organs | Eyes |
| Hazard Codes | F,T |
| Risk Statements | 11-23/24/25-39/23/24/25 |
| Safety Statements | 7-16-36/37-45 |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution |
| WGK Germany | 1 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 |
